C23H28N2OSSi — CID 58283961
N-(2-amino-5-thiophen-2-ylphenyl)-4-(3-trimethylsilylpropyl)benzamide (PubChem CID 58283961) has the molecular formula C23H28N2OSSi and a molecular weight of 408.64 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-(3-trimethylsilylpropyl)benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-(3-trimethylsilylpropyl)benzamide |
|---|---|
| PubChem CID | 58283961 |
| Molecular Formula | C23H28N2OSSi |
| Molecular Weight | 408.64 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-(3-trimethylsilylpropyl)benzamide |
| SMILES | C[Si](C)(C)CCCc1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1 |
| InChI | InChI=1S/C23H28N2OSSi/c1-28(2,3)15-5-6-17-8-10-18(11-9-17)23(26)25-21-16-19(12-13-20(21)24)22-7-4-14-27-22/h4,7-14,16H,5-6,15,24H2,1-3H3,(H,25,26) |
| InChIKey | GFWLLHNHXMTERC-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.64 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|