C24H24N4O3S — CID 145031072
N-(2-amino-5-thiophen-2-ylphenyl)-4-[2-(4-methyl-2,5-dioxopiperazin-1-yl)ethyl]benzamide (PubChem CID 145031072) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-[2-(4-methyl-2,5-dioxopiperazin-1-yl)ethyl]benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[2-(4-methyl-2,5-dioxopiperazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 145031072 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[2-(4-methyl-2,5-dioxopiperazin-1-yl)ethyl]benzamide |
| SMILES | CN1CC(=O)N(CCc2ccc(C(=O)Nc3cc(-c4cccs4)ccc3N)cc2)CC1=O |
| InChI | InChI=1S/C24H24N4O3S/c1-27-14-23(30)28(15-22(27)29)11-10-16-4-6-17(7-5-16)24(31)26-20-13-18(8-9-19(20)25)21-3-2-12-32-21/h2-9,12-13H,10-11,14-15,25H2,1H3,(H,26,31) |
| InChIKey | WZAWPUVFUZYXGW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|