C25H30N2O2SSi — CID 58283988
N-(2-amino-5-thiophen-2-ylphenyl)-4-(3-oxo-5-trimethylsilylpentyl)benzamide (PubChem CID 58283988) has the molecular formula C25H30N2O2SSi and a molecular weight of 450.68 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-(3-oxo-5-trimethylsilylpentyl)benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-(3-oxo-5-trimethylsilylpentyl)benzamide |
|---|---|
| PubChem CID | 58283988 |
| Molecular Formula | C25H30N2O2SSi |
| Molecular Weight | 450.68 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-(3-oxo-5-trimethylsilylpentyl)benzamide |
| SMILES | C[Si](C)(C)CCC(=O)CCc1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1 |
| InChI | InChI=1S/C25H30N2O2SSi/c1-31(2,3)16-14-21(28)12-8-18-6-9-19(10-7-18)25(29)27-23-17-20(11-13-22(23)26)24-5-4-15-30-24/h4-7,9-11,13,15,17H,8,12,14,16,26H2,1-3H3,(H,27,29) |
| InChIKey | JRSHBRLTALUBPV-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.68 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|