C25H29N3O2SSi — CID 58283991
N-(2-amino-5-thiophen-2-ylphenyl)-4-[3-[(5R)-3,3-dimethyl-1,3-azasilolidin-5-yl]-3-oxopropyl]benzamide (PubChem CID 58283991) has the molecular formula C25H29N3O2SSi and a molecular weight of 463.68 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-[3-[(5R)-3,3-dimethyl-1,3-azasilolidin-5-yl]-3-oxopropyl]benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[3-[(5R)-3,3-dimethyl-1,3-azasilolidin-5-yl]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 58283991 |
| Molecular Formula | C25H29N3O2SSi |
| Molecular Weight | 463.68 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[3-[(5R)-3,3-dimethyl-1,3-azasilolidin-5-yl]-3-oxopropyl]benzamide |
| SMILES | C[Si]1(C)CN[C@H](C(=O)CCc2ccc(C(=O)Nc3cc(-c4cccs4)ccc3N)cc2)C1 |
| InChI | InChI=1S/C25H29N3O2SSi/c1-32(2)15-22(27-16-32)23(29)12-7-17-5-8-18(9-6-17)25(30)28-21-14-19(10-11-20(21)26)24-4-3-13-31-24/h3-6,8-11,13-14,22,27H,7,12,15-16,26H2,1-2H3,(H,28,30)/t22-/m0/s1 |
| InChIKey | UVTKGYIAGNMTSL-QFIPXVFZSA-N |
| XLogP | 4.97 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|