C26H31N3O3SSi — CID 58283968
[(5R)-3,3-dimethyl-1,3-azasilolidin-5-yl]methyl 3-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]propanoate (PubChem CID 58283968) has the molecular formula C26H31N3O3SSi and a molecular weight of 493.71 g/mol. Its IUPAC name is [(5R)-3,3-dimethyl-1,3-azasilolidin-5-yl]methyl 3-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]propanoate.
| Compound Name | [(5R)-3,3-dimethyl-1,3-azasilolidin-5-yl]methyl 3-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]propanoate |
|---|---|
| PubChem CID | 58283968 |
| Molecular Formula | C26H31N3O3SSi |
| Molecular Weight | 493.71 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | [(5R)-3,3-dimethyl-1,3-azasilolidin-5-yl]methyl 3-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]propanoate |
| SMILES | C[Si]1(C)CN[C@H](COC(=O)CCc2ccc(C(=O)Nc3cc(-c4cccs4)ccc3N)cc2)C1 |
| InChI | InChI=1S/C26H31N3O3SSi/c1-34(2)16-21(28-17-34)15-32-25(30)12-7-18-5-8-19(9-6-18)26(31)29-23-14-20(10-11-22(23)27)24-4-3-13-33-24/h3-6,8-11,13-14,21,28H,7,12,15-17,27H2,1-2H3,(H,29,31)/t21-/m1/s1 |
| InChIKey | ZPBAGZTXJZRVRT-OAQYLSRUSA-N |
| XLogP | 4.94 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.71 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|