C27H27N5OS — CID 59737205
N-(2-amino-5-thiophen-2-ylphenyl)-4-[[(3S)-3-(pyridin-3-ylamino)pyrrolidin-1-yl]methyl]benzamide (PubChem CID 59737205) has the molecular formula C27H27N5OS and a molecular weight of 469.61 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-[[(3S)-3-(pyridin-3-ylamino)pyrrolidin-1-yl]methyl]benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[[(3S)-3-(pyridin-3-ylamino)pyrrolidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 59737205 |
| Molecular Formula | C27H27N5OS |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[[(3S)-3-(pyridin-3-ylamino)pyrrolidin-1-yl]methyl]benzamide |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc(CN2CC[C@H](Nc3cccnc3)C2)cc1 |
| InChI | InChI=1S/C27H27N5OS/c28-24-10-9-21(26-4-2-14-34-26)15-25(24)31-27(33)20-7-5-19(6-8-20)17-32-13-11-23(18-32)30-22-3-1-12-29-16-22/h1-10,12,14-16,23,30H,11,13,17-18,28H2,(H,31,33)/t23-/m0/s1 |
| InChIKey | YQNISYNNHDZILL-QHCPKHFHSA-N |
| XLogP | 5.33 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|