C31H38N4O2S2 — CID 143760407
N-(2-amino-5-thiophen-2-ylphenyl)-4-[[formyl(pyridin-3-ylmethyl)amino]methyl]benzamide;trimethyl(propyl)-λ4-sulfane (PubChem CID 143760407) has the molecular formula C31H38N4O2S2 and a molecular weight of 562.81 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-[[formyl(pyridin-3-ylmethyl)amino]methyl]benzamide;trimethyl(propyl)-λ4-sulfane.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[[formyl(pyridin-3-ylmethyl)amino]methyl]benzamide;trimethyl(propyl)-λ4-sulfane |
|---|---|
| PubChem CID | 143760407 |
| Molecular Formula | C31H38N4O2S2 |
| Molecular Weight | 562.81 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[[formyl(pyridin-3-ylmethyl)amino]methyl]benzamide;trimethyl(propyl)-λ4-sulfane |
| SMILES | CCCS(C)(C)C.Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc(CN(C=O)Cc2cccnc2)cc1 |
| InChI | InChI=1S/C25H22N4O2S.C6H16S/c26-22-10-9-21(24-4-2-12-32-24)13-23(22)28-25(31)20-7-5-18(6-8-20)15-29(17-30)16-19-3-1-11-27-14-19;1-5-6-7(2,3)4/h1-14,17H,15-16,26H2,(H,28,31);5-6H2,1-4H3 |
| InChIKey | KHPOZFRAUHYBBF-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.81 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|