C26H22N4O5S — CID 89441376
(2S)-2-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2-(pyridin-3-ylmethoxycarbonylamino)acetic acid (PubChem CID 89441376) has the molecular formula C26H22N4O5S and a molecular weight of 502.55 g/mol. Its IUPAC name is (2S)-2-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2-(pyridin-3-ylmethoxycarbonylamino)acetic acid.
| Compound Name | (2S)-2-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2-(pyridin-3-ylmethoxycarbonylamino)acetic acid |
|---|---|
| PubChem CID | 89441376 |
| Molecular Formula | C26H22N4O5S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | (2S)-2-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2-(pyridin-3-ylmethoxycarbonylamino)acetic acid |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc([C@H](NC(=O)OCc2cccnc2)C(=O)O)cc1 |
| InChI | InChI=1S/C26H22N4O5S/c27-20-10-9-19(22-4-2-12-36-22)13-21(20)29-24(31)18-7-5-17(6-8-18)23(25(32)33)30-26(34)35-15-16-3-1-11-28-14-16/h1-14,23H,15,27H2,(H,29,31)(H,30,34)(H,32,33)/t23-/m0/s1 |
| InChIKey | PKMHPZXBTQFFAH-QHCPKHFHSA-N |
| XLogP | 4.70 |
| TPSA | 143.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|