C23H28N3O4PS — CID 25012986
(2-amino-2-methylpropoxy)-[1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]ethyl]phosphinic acid (PubChem CID 25012986) has the molecular formula C23H28N3O4PS and a molecular weight of 473.54 g/mol. Its IUPAC name is (2-amino-2-methylpropoxy)-[1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]ethyl]phosphinic acid.
| Compound Name | (2-amino-2-methylpropoxy)-[1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]ethyl]phosphinic acid |
|---|---|
| PubChem CID | 25012986 |
| Molecular Formula | C23H28N3O4PS |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | (2-amino-2-methylpropoxy)-[1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]ethyl]phosphinic acid |
| SMILES | CC(c1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1)P(=O)(O)OCC(C)(C)N |
| InChI | InChI=1S/C23H28N3O4PS/c1-15(31(28,29)30-14-23(2,3)25)16-6-8-17(9-7-16)22(27)26-20-13-18(10-11-19(20)24)21-5-4-12-32-21/h4-13,15H,14,24-25H2,1-3H3,(H,26,27)(H,28,29) |
| InChIKey | MNNNMBYAFBDMLO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|