C25H24N3O4PS — CID 25012983
[1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2-pyridin-3-ylethyl]-methoxyphosphinic acid (PubChem CID 25012983) has the molecular formula C25H24N3O4PS and a molecular weight of 493.53 g/mol. Its IUPAC name is [1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2-pyridin-3-ylethyl]-methoxyphosphinic acid.
| Compound Name | [1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2-pyridin-3-ylethyl]-methoxyphosphinic acid |
|---|---|
| PubChem CID | 25012983 |
| Molecular Formula | C25H24N3O4PS |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | [1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2-pyridin-3-ylethyl]-methoxyphosphinic acid |
| SMILES | COP(=O)(O)C(Cc1cccnc1)c1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1 |
| InChI | InChI=1S/C25H24N3O4PS/c1-32-33(30,31)23(14-17-4-2-12-27-16-17)18-6-8-19(9-7-18)25(29)28-22-15-20(10-11-21(22)26)24-5-3-13-34-24/h2-13,15-16,23H,14,26H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | KGPDUVMWGFEQJV-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|