C22H22N4O4S — CID 89437890
[1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2-(ethylamino)-2-oxoethyl]carbamic acid (PubChem CID 89437890) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is [1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2-(ethylamino)-2-oxoethyl]carbamic acid.
| Compound Name | [1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2-(ethylamino)-2-oxoethyl]carbamic acid |
|---|---|
| PubChem CID | 89437890 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | [1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2-(ethylamino)-2-oxoethyl]carbamic acid |
| SMILES | CCNC(=O)C(NC(=O)O)c1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1 |
| InChI | InChI=1S/C22H22N4O4S/c1-2-24-21(28)19(26-22(29)30)13-5-7-14(8-6-13)20(27)25-17-12-15(9-10-16(17)23)18-4-3-11-31-18/h3-12,19,26H,2,23H2,1H3,(H,24,28)(H,25,27)(H,29,30) |
| InChIKey | OCZSNTLMBIGVBU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|