C35H32N4O3S — CID 67279472
2-[[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl]-N,N'-dibenzylpropanediamide (PubChem CID 67279472) has the molecular formula C35H32N4O3S and a molecular weight of 588.73 g/mol. Its IUPAC name is 2-[[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl]-N,N'-dibenzylpropanediamide.
| Compound Name | 2-[[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl]-N,N'-dibenzylpropanediamide |
|---|---|
| PubChem CID | 67279472 |
| Molecular Formula | C35H32N4O3S |
| Molecular Weight | 588.73 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | 2-[[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl]-N,N'-dibenzylpropanediamide |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc(CC(C(=O)NCc2ccccc2)C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C35H32N4O3S/c36-30-18-17-28(32-12-7-19-43-32)21-31(30)39-33(40)27-15-13-24(14-16-27)20-29(34(41)37-22-25-8-3-1-4-9-25)35(42)38-23-26-10-5-2-6-11-26/h1-19,21,29H,20,22-23,36H2,(H,37,41)(H,38,42)(H,39,40) |
| InChIKey | IQIRTJJOWPQLHA-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.73 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|