C27H28N4O2S — CID 139460044
N-(2-amino-5-thiophen-2-ylphenyl)-4-[(2-cyclopropyl-6-oxo-2,5-diazaspiro[3.4]octan-5-yl)methyl]benzamide (PubChem CID 139460044) has the molecular formula C27H28N4O2S and a molecular weight of 472.61 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-[(2-cyclopropyl-6-oxo-2,5-diazaspiro[3.4]octan-5-yl)methyl]benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[(2-cyclopropyl-6-oxo-2,5-diazaspiro[3.4]octan-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 139460044 |
| Molecular Formula | C27H28N4O2S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[(2-cyclopropyl-6-oxo-2,5-diazaspiro[3.4]octan-5-yl)methyl]benzamide |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc(CN2C(=O)CCC23CN(C2CC2)C3)cc1 |
| InChI | InChI=1S/C27H28N4O2S/c28-22-10-7-20(24-2-1-13-34-24)14-23(22)29-26(33)19-5-3-18(4-6-19)15-31-25(32)11-12-27(31)16-30(17-27)21-8-9-21/h1-7,10,13-14,21H,8-9,11-12,15-17,28H2,(H,29,33) |
| InChIKey | ZYZIIZWUSHYWEW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|