C23H21N3O2S — CID 143559660
1-[[4-[1-(2-amino-5-thiophen-2-ylanilino)ethenyl]phenyl]methyl]pyrrolidine-2,5-dione (PubChem CID 143559660) has the molecular formula C23H21N3O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is 1-[[4-[1-(2-amino-5-thiophen-2-ylanilino)ethenyl]phenyl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[4-[1-(2-amino-5-thiophen-2-ylanilino)ethenyl]phenyl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 143559660 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 1-[[4-[1-(2-amino-5-thiophen-2-ylanilino)ethenyl]phenyl]methyl]pyrrolidine-2,5-dione |
| SMILES | C=C(Nc1cc(-c2cccs2)ccc1N)c1ccc(CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C23H21N3O2S/c1-15(25-20-13-18(8-9-19(20)24)21-3-2-12-29-21)17-6-4-16(5-7-17)14-26-22(27)10-11-23(26)28/h2-9,12-13,25H,1,10-11,14,24H2 |
| InChIKey | QIFFRDFLFDARNT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|