C19H21N5OS2 — CID 134535394
N-(2-amino-5-thiophen-2-ylphenyl)-2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxamide (PubChem CID 134535394) has the molecular formula C19H21N5OS2 and a molecular weight of 399.55 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 134535394 |
| Molecular Formula | C19H21N5OS2 |
| Molecular Weight | 399.55 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxamide |
| SMILES | CN1CCN(c2ncc(C(=O)Nc3cc(-c4cccs4)ccc3N)s2)CC1 |
| InChI | InChI=1S/C19H21N5OS2/c1-23-6-8-24(9-7-23)19-21-12-17(27-19)18(25)22-15-11-13(4-5-14(15)20)16-3-2-10-26-16/h2-5,10-12H,6-9,20H2,1H3,(H,22,25) |
| InChIKey | UFFPDLROZFWPBV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|