C21H23N4O4PS — CID 69003485
[1-[5-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]-2-pyridinyl]piperidin-4-yl]phosphonic acid (PubChem CID 69003485) has the molecular formula C21H23N4O4PS and a molecular weight of 458.48 g/mol. Its IUPAC name is [1-[5-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]-2-pyridinyl]piperidin-4-yl]phosphonic acid.
| Compound Name | [1-[5-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]-2-pyridinyl]piperidin-4-yl]phosphonic acid |
|---|---|
| PubChem CID | 69003485 |
| Molecular Formula | C21H23N4O4PS |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | [1-[5-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]-2-pyridinyl]piperidin-4-yl]phosphonic acid |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc(N2CCC(P(=O)(O)O)CC2)nc1 |
| InChI | InChI=1S/C21H23N4O4PS/c22-17-5-3-14(19-2-1-11-31-19)12-18(17)24-21(26)15-4-6-20(23-13-15)25-9-7-16(8-10-25)30(27,28)29/h1-6,11-13,16H,7-10,22H2,(H,24,26)(H2,27,28,29) |
| InChIKey | LTQXSOCPIMFYTQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|