C25H27N5O2S — CID 139451621
N-(2-amino-5-thiophen-2-ylphenyl)-6-(3-oxo-2,9-diazaspiro[5.5]undecan-2-yl)pyridine-3-carboxamide (PubChem CID 139451621) has the molecular formula C25H27N5O2S and a molecular weight of 461.59 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-6-(3-oxo-2,9-diazaspiro[5.5]undecan-2-yl)pyridine-3-carboxamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-6-(3-oxo-2,9-diazaspiro[5.5]undecan-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139451621 |
| Molecular Formula | C25H27N5O2S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-6-(3-oxo-2,9-diazaspiro[5.5]undecan-2-yl)pyridine-3-carboxamide |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc(N2CC3(CCNCC3)CCC2=O)nc1 |
| InChI | InChI=1S/C25H27N5O2S/c26-19-5-3-17(21-2-1-13-33-21)14-20(19)29-24(32)18-4-6-22(28-15-18)30-16-25(8-7-23(30)31)9-11-27-12-10-25/h1-6,13-15,27H,7-12,16,26H2,(H,29,32) |
| InChIKey | VZLMSYBFEMEOLD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|