C16H12BrN3O2S — CID 59737416
N-(2-amino-5-thiophen-2-ylphenyl)-5-bromo-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 59737416) has the molecular formula C16H12BrN3O2S and a molecular weight of 390.26 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-5-bromo-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-5-bromo-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59737416 |
| Molecular Formula | C16H12BrN3O2S |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-5-bromo-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1c[nH]c(=O)c(Br)c1 |
| InChI | InChI=1S/C16H12BrN3O2S/c17-11-6-10(8-19-16(11)22)15(21)20-13-7-9(3-4-12(13)18)14-2-1-5-23-14/h1-8H,18H2,(H,19,22)(H,20,21) |
| InChIKey | PMQOGFDOGHNNFE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|