C23H19N3O2S2 — CID 168792402
N-(2-amino-5-thiophen-2-ylphenyl)-4-(phenylsulfonimidoyl)benzamide (PubChem CID 168792402) has the molecular formula C23H19N3O2S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-(phenylsulfonimidoyl)benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-(phenylsulfonimidoyl)benzamide |
|---|---|
| PubChem CID | 168792402 |
| Molecular Formula | C23H19N3O2S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-(phenylsulfonimidoyl)benzamide |
| SMILES | [H]N=S(=O)(c1ccccc1)c1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1 |
| InChI | InChI=1S/C23H19N3O2S2/c24-20-13-10-17(22-7-4-14-29-22)15-21(20)26-23(27)16-8-11-19(12-9-16)30(25,28)18-5-2-1-3-6-18/h1-15,25H,24H2,(H,26,27) |
| InChIKey | MGECDDFSLCKALV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|