C20H17N3O3S2 — CID 168792406
N-(2-amino-5-thiophen-2-ylphenyl)-5-(methylsulfonimidoyl)-1-benzofuran-2-carboxamide (PubChem CID 168792406) has the molecular formula C20H17N3O3S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-5-(methylsulfonimidoyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-5-(methylsulfonimidoyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 168792406 |
| Molecular Formula | C20H17N3O3S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-5-(methylsulfonimidoyl)-1-benzofuran-2-carboxamide |
| SMILES | [H]N=S(C)(=O)c1ccc2oc(C(=O)Nc3cc(-c4cccs4)ccc3N)cc2c1 |
| InChI | InChI=1S/C20H17N3O3S2/c1-28(22,25)14-5-7-17-13(9-14)11-18(26-17)20(24)23-16-10-12(4-6-15(16)21)19-3-2-8-27-19/h2-11,22H,21H2,1H3,(H,23,24) |
| InChIKey | AOZSDKOHUMRXKZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 109.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|