C17H13FN2O2S — CID 150946736
N-(2-amino-5-thiophen-2-ylphenyl)-2-fluoro-4-hydroxybenzamide (PubChem CID 150946736) has the molecular formula C17H13FN2O2S and a molecular weight of 328.37 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-2-fluoro-4-hydroxybenzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-2-fluoro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 150946736 |
| Molecular Formula | C17H13FN2O2S |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-2-fluoro-4-hydroxybenzamide |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc(O)cc1F |
| InChI | InChI=1S/C17H13FN2O2S/c18-13-9-11(21)4-5-12(13)17(22)20-15-8-10(3-6-14(15)19)16-2-1-7-23-16/h1-9,21H,19H2,(H,20,22) |
| InChIKey | LJFKDCOBBIFUQL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|