C23H22N4O4S — CID 139460390
N-(2-amino-5-thiophen-2-ylphenyl)-6-(2-oxo-1,8-dioxa-3-azaspiro[4.5]decan-3-yl)pyridine-3-carboxamide (PubChem CID 139460390) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-6-(2-oxo-1,8-dioxa-3-azaspiro[4.5]decan-3-yl)pyridine-3-carboxamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-6-(2-oxo-1,8-dioxa-3-azaspiro[4.5]decan-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139460390 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-6-(2-oxo-1,8-dioxa-3-azaspiro[4.5]decan-3-yl)pyridine-3-carboxamide |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc(N2CC3(CCOCC3)OC2=O)nc1 |
| InChI | InChI=1S/C23H22N4O4S/c24-17-5-3-15(19-2-1-11-32-19)12-18(17)26-21(28)16-4-6-20(25-13-16)27-14-23(31-22(27)29)7-9-30-10-8-23/h1-6,11-13H,7-10,14,24H2,(H,26,28) |
| InChIKey | NKOBCSZRALGKFA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|