C24H26N4O4 — CID 66893989
N-(2-aminophenyl)-3-[6-[(3,4,5-trimethoxyphenyl)methylamino]-3-pyridinyl]prop-2-enamide (PubChem CID 66893989) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-[6-[(3,4,5-trimethoxyphenyl)methylamino]-3-pyridinyl]prop-2-enamide.
| Compound Name | N-(2-aminophenyl)-3-[6-[(3,4,5-trimethoxyphenyl)methylamino]-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 66893989 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-(2-aminophenyl)-3-[6-[(3,4,5-trimethoxyphenyl)methylamino]-3-pyridinyl]prop-2-enamide |
| SMILES | COc1cc(CNc2ccc(C=CC(=O)Nc3ccccc3N)cn2)cc(OC)c1OC |
| InChI | InChI=1S/C24H26N4O4/c1-30-20-12-17(13-21(31-2)24(20)32-3)15-27-22-10-8-16(14-26-22)9-11-23(29)28-19-7-5-4-6-18(19)25/h4-14H,15,25H2,1-3H3,(H,26,27)(H,28,29) |
| InChIKey | CUYARGQDZDCBCV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|