C21H21N5O2 — CID 66893848
N-(2-aminophenyl)-3-[2-[(4-methoxyphenyl)methylamino]pyrimidin-5-yl]prop-2-enamide (PubChem CID 66893848) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-[2-[(4-methoxyphenyl)methylamino]pyrimidin-5-yl]prop-2-enamide.
| Compound Name | N-(2-aminophenyl)-3-[2-[(4-methoxyphenyl)methylamino]pyrimidin-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 66893848 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-(2-aminophenyl)-3-[2-[(4-methoxyphenyl)methylamino]pyrimidin-5-yl]prop-2-enamide |
| SMILES | COc1ccc(CNc2ncc(C=CC(=O)Nc3ccccc3N)cn2)cc1 |
| InChI | InChI=1S/C21H21N5O2/c1-28-17-9-6-15(7-10-17)12-23-21-24-13-16(14-25-21)8-11-20(27)26-19-5-3-2-4-18(19)22/h2-11,13-14H,12,22H2,1H3,(H,26,27)(H,23,24,25) |
| InChIKey | VSIYZOJOVVBCJW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|