C22H20ClN3O — CID 66893901
N-(2-aminophenyl)-3-[4-[(3-chloroanilino)methyl]phenyl]prop-2-enamide (PubChem CID 66893901) has the molecular formula C22H20ClN3O and a molecular weight of 377.88 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-[4-[(3-chloroanilino)methyl]phenyl]prop-2-enamide.
| Compound Name | N-(2-aminophenyl)-3-[4-[(3-chloroanilino)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 66893901 |
| Molecular Formula | C22H20ClN3O |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-(2-aminophenyl)-3-[4-[(3-chloroanilino)methyl]phenyl]prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)C=Cc1ccc(CNc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C22H20ClN3O/c23-18-4-3-5-19(14-18)25-15-17-10-8-16(9-11-17)12-13-22(27)26-21-7-2-1-6-20(21)24/h1-14,25H,15,24H2,(H,26,27) |
| InChIKey | FNBPELCUJKTQLE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|