C15H13BrN2O — CID 69082586
N-(2-aminophenyl)-3-(4-bromophenyl)prop-2-enamide (PubChem CID 69082586) has the molecular formula C15H13BrN2O and a molecular weight of 317.19 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-(4-bromophenyl)prop-2-enamide.
| Compound Name | N-(2-aminophenyl)-3-(4-bromophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 69082586 |
| Molecular Formula | C15H13BrN2O |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | N-(2-aminophenyl)-3-(4-bromophenyl)prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)C=Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H13BrN2O/c16-12-8-5-11(6-9-12)7-10-15(19)18-14-4-2-1-3-13(14)17/h1-10H,17H2,(H,18,19) |
| InChIKey | GZJIMHMVQYBZQJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|