C27H30BrN5O2 — CID 68513621
N-(2-aminophenyl)-3-[4-[2-(4-bromoanilino)-1-[2-(dimethylamino)ethylamino]-2-oxoethyl]phenyl]prop-2-enamide (PubChem CID 68513621) has the molecular formula C27H30BrN5O2 and a molecular weight of 536.47 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-[4-[2-(4-bromoanilino)-1-[2-(dimethylamino)ethylamino]-2-oxoethyl]phenyl]prop-2-enamide.
| Compound Name | N-(2-aminophenyl)-3-[4-[2-(4-bromoanilino)-1-[2-(dimethylamino)ethylamino]-2-oxoethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 68513621 |
| Molecular Formula | C27H30BrN5O2 |
| Molecular Weight | 536.47 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | N-(2-aminophenyl)-3-[4-[2-(4-bromoanilino)-1-[2-(dimethylamino)ethylamino]-2-oxoethyl]phenyl]prop-2-enamide |
| SMILES | CN(C)CCNC(C(=O)Nc1ccc(Br)cc1)c1ccc(C=CC(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C27H30BrN5O2/c1-33(2)18-17-30-26(27(35)31-22-14-12-21(28)13-15-22)20-10-7-19(8-11-20)9-16-25(34)32-24-6-4-3-5-23(24)29/h3-16,26,30H,17-18,29H2,1-2H3,(H,31,35)(H,32,34) |
| InChIKey | SDBLDRDWQSUREL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|