C33H39N5O2 — CID 68513607
N-(2-aminophenyl)-3-[4-[2-(4-cyclopropylanilino)-2-oxo-1-(2-piperidin-1-ylethylamino)ethyl]phenyl]prop-2-enamide (PubChem CID 68513607) has the molecular formula C33H39N5O2 and a molecular weight of 537.71 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-[4-[2-(4-cyclopropylanilino)-2-oxo-1-(2-piperidin-1-ylethylamino)ethyl]phenyl]prop-2-enamide.
| Compound Name | N-(2-aminophenyl)-3-[4-[2-(4-cyclopropylanilino)-2-oxo-1-(2-piperidin-1-ylethylamino)ethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 68513607 |
| Molecular Formula | C33H39N5O2 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | N-(2-aminophenyl)-3-[4-[2-(4-cyclopropylanilino)-2-oxo-1-(2-piperidin-1-ylethylamino)ethyl]phenyl]prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)C=Cc1ccc(C(NCCN2CCCCC2)C(=O)Nc2ccc(C3CC3)cc2)cc1 |
| InChI | InChI=1S/C33H39N5O2/c34-29-6-2-3-7-30(29)37-31(39)19-10-24-8-11-27(12-9-24)32(35-20-23-38-21-4-1-5-22-38)33(40)36-28-17-15-26(16-18-28)25-13-14-25/h2-3,6-12,15-19,25,32,35H,1,4-5,13-14,20-23,34H2,(H,36,40)(H,37,39) |
| InChIKey | JFMYZNIWQJZXIC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|