C34H41N5O3 — CID 91458316
N-(2-aminophenyl)-3-[4-[(1S)-2-(4-tert-butylanilino)-1-[2-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)ethylamino]-2-oxoethyl]phenyl]prop-2-enamide (PubChem CID 91458316) has the molecular formula C34H41N5O3 and a molecular weight of 567.73 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-[4-[(1S)-2-(4-tert-butylanilino)-1-[2-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)ethylamino]-2-oxoethyl]phenyl]prop-2-enamide.
| Compound Name | N-(2-aminophenyl)-3-[4-[(1S)-2-(4-tert-butylanilino)-1-[2-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)ethylamino]-2-oxoethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 91458316 |
| Molecular Formula | C34H41N5O3 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.32 |
| IUPAC Name | N-(2-aminophenyl)-3-[4-[(1S)-2-(4-tert-butylanilino)-1-[2-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)ethylamino]-2-oxoethyl]phenyl]prop-2-enamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)[C@@H](NCCN2CC3CC2CO3)c2ccc(C=CC(=O)Nc3ccccc3N)cc2)cc1 |
| InChI | InChI=1S/C34H41N5O3/c1-34(2,3)25-13-15-26(16-14-25)37-33(41)32(36-18-19-39-21-28-20-27(39)22-42-28)24-11-8-23(9-12-24)10-17-31(40)38-30-7-5-4-6-29(30)35/h4-17,27-28,32,36H,18-22,35H2,1-3H3,(H,37,41)(H,38,40)/t27?,28?,32-/m0/s1 |
| InChIKey | JCUMRODNFJPZBH-HMELLBQWSA-N |
| XLogP | 4.96 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|