C31H33F4N5O3 — CID 89030875
(E)-N-(2-aminophenyl)-3-[4-[2-[3-fluoro-4-(trifluoromethyl)anilino]-1-[2-(3-methylmorpholin-4-yl)ethylamino]-2-oxoethyl]phenyl]prop-2-enamide (PubChem CID 89030875) has the molecular formula C31H33F4N5O3 and a molecular weight of 599.63 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[4-[2-[3-fluoro-4-(trifluoromethyl)anilino]-1-[2-(3-methylmorpholin-4-yl)ethylamino]-2-oxoethyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-[4-[2-[3-fluoro-4-(trifluoromethyl)anilino]-1-[2-(3-methylmorpholin-4-yl)ethylamino]-2-oxoethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 89030875 |
| Molecular Formula | C31H33F4N5O3 |
| Molecular Weight | 599.63 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[4-[2-[3-fluoro-4-(trifluoromethyl)anilino]-1-[2-(3-methylmorpholin-4-yl)ethylamino]-2-oxoethyl]phenyl]prop-2-enamide |
| SMILES | CC1COCCN1CCNC(C(=O)Nc1ccc(C(F)(F)F)c(F)c1)c1ccc(/C=C/C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C31H33F4N5O3/c1-20-19-43-17-16-40(20)15-14-37-29(30(42)38-23-11-12-24(25(32)18-23)31(33,34)35)22-9-6-21(7-10-22)8-13-28(41)39-27-5-3-2-4-26(27)36/h2-13,18,20,29,37H,14-17,19,36H2,1H3,(H,38,42)(H,39,41)/b13-8+ |
| InChIKey | MNMLWXWVIDFPPX-MDWZMJQESA-N |
| XLogP | 5.07 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|