C31H34F3N5O3 — CID 53324670
(E)-N-(2-aminophenyl)-3-[4-[1-(3-morpholin-4-ylpropylamino)-2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]phenyl]prop-2-enamide (PubChem CID 53324670) has the molecular formula C31H34F3N5O3 and a molecular weight of 581.64 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[4-[1-(3-morpholin-4-ylpropylamino)-2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-[4-[1-(3-morpholin-4-ylpropylamino)-2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 53324670 |
| Molecular Formula | C31H34F3N5O3 |
| Molecular Weight | 581.64 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[4-[1-(3-morpholin-4-ylpropylamino)-2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]phenyl]prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1ccc(C(NCCCN2CCOCC2)C(=O)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C31H34F3N5O3/c32-31(33,34)24-11-13-25(14-12-24)37-30(41)29(36-16-3-17-39-18-20-42-21-19-39)23-9-6-22(7-10-23)8-15-28(40)38-27-5-2-1-4-26(27)35/h1-2,4-15,29,36H,3,16-21,35H2,(H,37,41)(H,38,40)/b15-8+ |
| InChIKey | FPLVTYMXNZPEQO-OVCLIPMQSA-N |
| XLogP | 4.93 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.64 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|