C32H34F3N5O3 — CID 162586420
(E)-N-[2-(methylideneamino)phenyl]-3-[4-[1-(3-morpholin-4-ylpropylamino)-2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]phenyl]prop-2-enamide (PubChem CID 162586420) has the molecular formula C32H34F3N5O3 and a molecular weight of 593.65 g/mol. Its IUPAC name is (E)-N-[2-(methylideneamino)phenyl]-3-[4-[1-(3-morpholin-4-ylpropylamino)-2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-(methylideneamino)phenyl]-3-[4-[1-(3-morpholin-4-ylpropylamino)-2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 162586420 |
| Molecular Formula | C32H34F3N5O3 |
| Molecular Weight | 593.65 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | (E)-N-[2-(methylideneamino)phenyl]-3-[4-[1-(3-morpholin-4-ylpropylamino)-2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]phenyl]prop-2-enamide |
| SMILES | C=Nc1ccccc1NC(=O)/C=C/c1ccc(C(NCCCN2CCOCC2)C(=O)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C32H34F3N5O3/c1-36-27-5-2-3-6-28(27)39-29(41)16-9-23-7-10-24(11-8-23)30(37-17-4-18-40-19-21-43-22-20-40)31(42)38-26-14-12-25(13-15-26)32(33,34)35/h2-3,5-16,30,37H,1,4,17-22H2,(H,38,42)(H,39,41)/b16-9+ |
| InChIKey | QFVJIXNVMDXCQU-CXUHLZMHSA-N |
| XLogP | 5.68 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.65 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|