C31H34F3N5O4 — CID 68509270
N-(2-aminophenyl)-3-[4-[1-[methyl(2-morpholin-4-ylethyl)amino]-2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]phenyl]prop-2-enamide (PubChem CID 68509270) has the molecular formula C31H34F3N5O4 and a molecular weight of 597.64 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-[4-[1-[methyl(2-morpholin-4-ylethyl)amino]-2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]phenyl]prop-2-enamide.
| Compound Name | N-(2-aminophenyl)-3-[4-[1-[methyl(2-morpholin-4-ylethyl)amino]-2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 68509270 |
| Molecular Formula | C31H34F3N5O4 |
| Molecular Weight | 597.64 g/mol |
| Exact Mass | 597.26 |
| IUPAC Name | N-(2-aminophenyl)-3-[4-[1-[methyl(2-morpholin-4-ylethyl)amino]-2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]phenyl]prop-2-enamide |
| SMILES | CN(CCN1CCOCC1)C(C(=O)Nc1ccc(OC(F)(F)F)cc1)c1ccc(C=CC(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C31H34F3N5O4/c1-38(16-17-39-18-20-42-21-19-39)29(30(41)36-24-11-13-25(14-12-24)43-31(32,33)34)23-9-6-22(7-10-23)8-15-28(40)37-27-5-3-2-4-26(27)35/h2-15,29H,16-21,35H2,1H3,(H,36,41)(H,37,40) |
| InChIKey | NGEXLKRIUQWZDG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.64 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|