C31H38N4O5 — CID 20785978
(E)-N-(2-aminophenyl)-3-[4-[[3,4,5-trimethoxy-N-(2-morpholin-4-ylethyl)anilino]methyl]phenyl]prop-2-enamide (PubChem CID 20785978) has the molecular formula C31H38N4O5 and a molecular weight of 546.67 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[4-[[3,4,5-trimethoxy-N-(2-morpholin-4-ylethyl)anilino]methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-[4-[[3,4,5-trimethoxy-N-(2-morpholin-4-ylethyl)anilino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 20785978 |
| Molecular Formula | C31H38N4O5 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[4-[[3,4,5-trimethoxy-N-(2-morpholin-4-ylethyl)anilino]methyl]phenyl]prop-2-enamide |
| SMILES | COc1cc(N(CCN2CCOCC2)Cc2ccc(/C=C/C(=O)Nc3ccccc3N)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C31H38N4O5/c1-37-28-20-25(21-29(38-2)31(28)39-3)35(15-14-34-16-18-40-19-17-34)22-24-10-8-23(9-11-24)12-13-30(36)33-27-7-5-4-6-26(27)32/h4-13,20-21H,14-19,22,32H2,1-3H3,(H,33,36)/b13-12+ |
| InChIKey | UAYDWXWVZWHIEW-OUKQBFOZSA-N |
| XLogP | 4.29 |
| TPSA | 98.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|