C25H28N4O4 — CID 66893238
(Z)-N-(2-aminophenyl)-3-[3-amino-4-[(3,4,5-trimethoxyanilino)methyl]phenyl]prop-2-enamide (PubChem CID 66893238) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is (Z)-N-(2-aminophenyl)-3-[3-amino-4-[(3,4,5-trimethoxyanilino)methyl]phenyl]prop-2-enamide.
| Compound Name | (Z)-N-(2-aminophenyl)-3-[3-amino-4-[(3,4,5-trimethoxyanilino)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 66893238 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | (Z)-N-(2-aminophenyl)-3-[3-amino-4-[(3,4,5-trimethoxyanilino)methyl]phenyl]prop-2-enamide |
| SMILES | COc1cc(NCc2ccc(/C=C\C(=O)Nc3ccccc3N)cc2N)cc(OC)c1OC |
| InChI | InChI=1S/C25H28N4O4/c1-31-22-13-18(14-23(32-2)25(22)33-3)28-15-17-10-8-16(12-20(17)27)9-11-24(30)29-21-7-5-4-6-19(21)26/h4-14,28H,15,26-27H2,1-3H3,(H,29,30)/b11-9- |
| InChIKey | IWQQSDUEGSLMPK-LUAWRHEFSA-N |
| XLogP | 4.14 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|