C22H21N3O — CID 139368358
(E)-N-(2-aminophenyl)-3-[3-(anilinomethyl)phenyl]prop-2-enamide (PubChem CID 139368358) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[3-(anilinomethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-[3-(anilinomethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 139368358 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[3-(anilinomethyl)phenyl]prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1cccc(CNc2ccccc2)c1 |
| InChI | InChI=1S/C22H21N3O/c23-20-11-4-5-12-21(20)25-22(26)14-13-17-7-6-8-18(15-17)16-24-19-9-2-1-3-10-19/h1-15,24H,16,23H2,(H,25,26)/b14-13+ |
| InChIKey | MPVOOKQJDKBMDN-BUHFOSPRSA-N |
| XLogP | 4.53 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|