C25H22N4O — CID 139368383
(E)-N-(2-aminophenyl)-3-[3-[(quinolin-6-ylamino)methyl]phenyl]prop-2-enamide (PubChem CID 139368383) has the molecular formula C25H22N4O and a molecular weight of 394.48 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[3-[(quinolin-6-ylamino)methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-[3-[(quinolin-6-ylamino)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 139368383 |
| Molecular Formula | C25H22N4O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[3-[(quinolin-6-ylamino)methyl]phenyl]prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1cccc(CNc2ccc3ncccc3c2)c1 |
| InChI | InChI=1S/C25H22N4O/c26-22-8-1-2-9-24(22)29-25(30)13-10-18-5-3-6-19(15-18)17-28-21-11-12-23-20(16-21)7-4-14-27-23/h1-16,28H,17,26H2,(H,29,30)/b13-10+ |
| InChIKey | PDSYBBMRWCYXHB-JLHYYAGUSA-N |
| XLogP | 5.08 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|