C29H29N5O2 — CID 68511126
N-(2-aminophenyl)-3-[4-[2-oxo-2-(propan-2-ylamino)-1-(quinolin-6-ylamino)ethyl]phenyl]prop-2-enamide (PubChem CID 68511126) has the molecular formula C29H29N5O2 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-[4-[2-oxo-2-(propan-2-ylamino)-1-(quinolin-6-ylamino)ethyl]phenyl]prop-2-enamide.
| Compound Name | N-(2-aminophenyl)-3-[4-[2-oxo-2-(propan-2-ylamino)-1-(quinolin-6-ylamino)ethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 68511126 |
| Molecular Formula | C29H29N5O2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | N-(2-aminophenyl)-3-[4-[2-oxo-2-(propan-2-ylamino)-1-(quinolin-6-ylamino)ethyl]phenyl]prop-2-enamide |
| SMILES | CC(C)NC(=O)C(Nc1ccc2ncccc2c1)c1ccc(C=CC(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C29H29N5O2/c1-19(2)32-29(36)28(33-23-14-15-25-22(18-23)6-5-17-31-25)21-12-9-20(10-13-21)11-16-27(35)34-26-8-4-3-7-24(26)30/h3-19,28,33H,30H2,1-2H3,(H,32,36)(H,34,35) |
| InChIKey | WXPHLDRWZJCYHE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|