C27H28ClN5O3 — CID 68509813
3-[4-[1-(2-acetamidoethylamino)-2-(4-chloroanilino)-2-oxoethyl]phenyl]-N-(2-aminophenyl)prop-2-enamide (PubChem CID 68509813) has the molecular formula C27H28ClN5O3 and a molecular weight of 506.01 g/mol. Its IUPAC name is 3-[4-[1-(2-acetamidoethylamino)-2-(4-chloroanilino)-2-oxoethyl]phenyl]-N-(2-aminophenyl)prop-2-enamide.
| Compound Name | 3-[4-[1-(2-acetamidoethylamino)-2-(4-chloroanilino)-2-oxoethyl]phenyl]-N-(2-aminophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 68509813 |
| Molecular Formula | C27H28ClN5O3 |
| Molecular Weight | 506.01 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 3-[4-[1-(2-acetamidoethylamino)-2-(4-chloroanilino)-2-oxoethyl]phenyl]-N-(2-aminophenyl)prop-2-enamide |
| SMILES | CC(=O)NCCNC(C(=O)Nc1ccc(Cl)cc1)c1ccc(C=CC(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C27H28ClN5O3/c1-18(34)30-16-17-31-26(27(36)32-22-13-11-21(28)12-14-22)20-9-6-19(7-10-20)8-15-25(35)33-24-5-3-2-4-23(24)29/h2-15,26,31H,16-17,29H2,1H3,(H,30,34)(H,32,36)(H,33,35) |
| InChIKey | OGOGJMUBWJDSLX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.01 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|