C29H29ClF2N4O2 — CID 59238339
2-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chlorophenyl)-3-(4,4-difluoropiperidin-1-yl)propanamide (PubChem CID 59238339) has the molecular formula C29H29ClF2N4O2 and a molecular weight of 539.03 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chlorophenyl)-3-(4,4-difluoropiperidin-1-yl)propanamide.
| Compound Name | 2-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chlorophenyl)-3-(4,4-difluoropiperidin-1-yl)propanamide |
|---|---|
| PubChem CID | 59238339 |
| Molecular Formula | C29H29ClF2N4O2 |
| Molecular Weight | 539.03 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 2-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chlorophenyl)-3-(4,4-difluoropiperidin-1-yl)propanamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1ccc(C(CN2CCC(F)(F)CC2)C(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C29H29ClF2N4O2/c30-22-10-12-23(13-11-22)34-28(38)24(19-36-17-15-29(31,32)16-18-36)21-8-5-20(6-9-21)7-14-27(37)35-26-4-2-1-3-25(26)33/h1-14,24H,15-19,33H2,(H,34,38)(H,35,37)/b14-7+ |
| InChIKey | HNYBMVZHBXOKRK-VGOFMYFVSA-N |
| XLogP | 6.03 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.03 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|