C30H33ClN4O3 — CID 59454157
(3S,4R)-4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chlorophenyl)-1-(2-hydroxy-2-methylpropyl)pyrrolidine-3-carboxamide (PubChem CID 59454157) has the molecular formula C30H33ClN4O3 and a molecular weight of 533.07 g/mol. Its IUPAC name is (3S,4R)-4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chlorophenyl)-1-(2-hydroxy-2-methylpropyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chlorophenyl)-1-(2-hydroxy-2-methylpropyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 59454157 |
| Molecular Formula | C30H33ClN4O3 |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | (3S,4R)-4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chlorophenyl)-1-(2-hydroxy-2-methylpropyl)pyrrolidine-3-carboxamide |
| SMILES | CC(C)(O)CN1C[C@@H](C(=O)Nc2ccc(Cl)cc2)[C@H](c2ccc(/C=C/C(=O)Nc3ccccc3N)cc2)C1 |
| InChI | InChI=1S/C30H33ClN4O3/c1-30(2,38)19-35-17-24(25(18-35)29(37)33-23-14-12-22(31)13-15-23)21-10-7-20(8-11-21)9-16-28(36)34-27-6-4-3-5-26(27)32/h3-16,24-25,38H,17-19,32H2,1-2H3,(H,33,37)(H,34,36)/b16-9+/t24-,25+/m0/s1 |
| InChIKey | KDHZEOLHBGWCJL-WKQQXXLOSA-N |
| XLogP | 5.00 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|