C30H33FN4O2 — CID 46896650
4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-1-tert-butyl-N-(4-fluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 46896650) has the molecular formula C30H33FN4O2 and a molecular weight of 500.62 g/mol. Its IUPAC name is 4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-1-tert-butyl-N-(4-fluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | 4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-1-tert-butyl-N-(4-fluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46896650 |
| Molecular Formula | C30H33FN4O2 |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | 4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-1-tert-butyl-N-(4-fluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | CC(C)(C)N1CC(C(=O)Nc2ccc(F)cc2)C(c2ccc(/C=C/C(=O)Nc3ccccc3N)cc2)C1 |
| InChI | InChI=1S/C30H33FN4O2/c1-30(2,3)35-18-24(25(19-35)29(37)33-23-15-13-22(31)14-16-23)21-11-8-20(9-12-21)10-17-28(36)34-27-7-5-4-6-26(27)32/h4-17,24-25H,18-19,32H2,1-3H3,(H,33,37)(H,34,36)/b17-10+ |
| InChIKey | LIHMVOWLUVBSEA-LICLKQGHSA-N |
| XLogP | 5.51 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|