C26H26FN5O2 — CID 59454188
4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(5-fluoro-2-pyridinyl)-1-methylpyrrolidine-3-carboxamide (PubChem CID 59454188) has the molecular formula C26H26FN5O2 and a molecular weight of 459.53 g/mol. Its IUPAC name is 4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(5-fluoro-2-pyridinyl)-1-methylpyrrolidine-3-carboxamide.
| Compound Name | 4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(5-fluoro-2-pyridinyl)-1-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 59454188 |
| Molecular Formula | C26H26FN5O2 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(5-fluoro-2-pyridinyl)-1-methylpyrrolidine-3-carboxamide |
| SMILES | CN1CC(C(=O)Nc2ccc(F)cn2)C(c2ccc(/C=C/C(=O)Nc3ccccc3N)cc2)C1 |
| InChI | InChI=1S/C26H26FN5O2/c1-32-15-20(21(16-32)26(34)31-24-12-11-19(27)14-29-24)18-9-6-17(7-10-18)8-13-25(33)30-23-5-3-2-4-22(23)28/h2-14,20-21H,15-16,28H2,1H3,(H,30,33)(H,29,31,34)/b13-8+ |
| InChIKey | MGZGJCQQKLQCMR-MDWZMJQESA-N |
| XLogP | 3.74 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|