C28H29ClN4O3 — CID 75231279
4-[4-[3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chloro-3-methoxyphenyl)-1-methylpyrrolidine-3-carboxamide (PubChem CID 75231279) has the molecular formula C28H29ClN4O3 and a molecular weight of 505.02 g/mol. Its IUPAC name is 4-[4-[3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chloro-3-methoxyphenyl)-1-methylpyrrolidine-3-carboxamide.
| Compound Name | 4-[4-[3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chloro-3-methoxyphenyl)-1-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 75231279 |
| Molecular Formula | C28H29ClN4O3 |
| Molecular Weight | 505.02 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 4-[4-[3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chloro-3-methoxyphenyl)-1-methylpyrrolidine-3-carboxamide |
| SMILES | COc1cc(NC(=O)C2CN(C)CC2c2ccc(C=CC(=O)Nc3ccccc3N)cc2)ccc1Cl |
| InChI | InChI=1S/C28H29ClN4O3/c1-33-16-21(22(17-33)28(35)31-20-12-13-23(29)26(15-20)36-2)19-10-7-18(8-11-19)9-14-27(34)32-25-6-4-3-5-24(25)30/h3-15,21-22H,16-17,30H2,1-2H3,(H,31,35)(H,32,34) |
| InChIKey | PJRGSFNRQKMGDW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.02 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|