C29H31BrN4O2 — CID 75230820
4-[4-[3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-bromophenyl)-1-propan-2-ylpyrrolidine-3-carboxamide (PubChem CID 75230820) has the molecular formula C29H31BrN4O2 and a molecular weight of 547.50 g/mol. Its IUPAC name is 4-[4-[3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-bromophenyl)-1-propan-2-ylpyrrolidine-3-carboxamide.
| Compound Name | 4-[4-[3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-bromophenyl)-1-propan-2-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 75230820 |
| Molecular Formula | C29H31BrN4O2 |
| Molecular Weight | 547.50 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | 4-[4-[3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-bromophenyl)-1-propan-2-ylpyrrolidine-3-carboxamide |
| SMILES | CC(C)N1CC(C(=O)Nc2ccc(Br)cc2)C(c2ccc(C=CC(=O)Nc3ccccc3N)cc2)C1 |
| InChI | InChI=1S/C29H31BrN4O2/c1-19(2)34-17-24(25(18-34)29(36)32-23-14-12-22(30)13-15-23)21-10-7-20(8-11-21)9-16-28(35)33-27-6-4-3-5-26(27)31/h3-16,19,24-25H,17-18,31H2,1-2H3,(H,32,36)(H,33,35) |
| InChIKey | JSADBGRLNQLDAH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|