C34H31F3N4O2 — CID 59454265
4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-1-benzyl-N-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 59454265) has the molecular formula C34H31F3N4O2 and a molecular weight of 584.64 g/mol. Its IUPAC name is 4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-1-benzyl-N-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | 4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-1-benzyl-N-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 59454265 |
| Molecular Formula | C34H31F3N4O2 |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | 4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-1-benzyl-N-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1ccc(C2CN(Cc3ccccc3)CC2C(=O)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C34H31F3N4O2/c35-34(36,37)26-15-17-27(18-16-26)39-33(43)29-22-41(20-24-6-2-1-3-7-24)21-28(29)25-13-10-23(11-14-25)12-19-32(42)40-31-9-5-4-8-30(31)38/h1-19,28-29H,20-22,38H2,(H,39,43)(H,40,42)/b19-12+ |
| InChIKey | CZRQEUZQFNOZNK-XDHOZWIPSA-N |
| XLogP | 6.79 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|