C27H25F3N4O2 — CID 68508278
N-(2-aminophenyl)-3-[4-[1-(azetidin-1-yl)-2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]phenyl]prop-2-enamide (PubChem CID 68508278) has the molecular formula C27H25F3N4O2 and a molecular weight of 494.52 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-[4-[1-(azetidin-1-yl)-2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]phenyl]prop-2-enamide.
| Compound Name | N-(2-aminophenyl)-3-[4-[1-(azetidin-1-yl)-2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 68508278 |
| Molecular Formula | C27H25F3N4O2 |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | N-(2-aminophenyl)-3-[4-[1-(azetidin-1-yl)-2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]phenyl]prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)C=Cc1ccc(C(C(=O)Nc2ccc(C(F)(F)F)cc2)N2CCC2)cc1 |
| InChI | InChI=1S/C27H25F3N4O2/c28-27(29,30)20-11-13-21(14-12-20)32-26(36)25(34-16-3-17-34)19-9-6-18(7-10-19)8-15-24(35)33-23-5-2-1-4-22(23)31/h1-2,4-15,25H,3,16-17,31H2,(H,32,36)(H,33,35) |
| InChIKey | RVVIWDOFXCSPHA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|