C26H32N4O4 — CID 91165032
N-(2-aminophenyl)-3-[4-[1-[(3S)-3-hydroxypyrrolidin-1-yl]-2-(oxan-4-ylamino)-2-oxoethyl]phenyl]prop-2-enamide (PubChem CID 91165032) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-[4-[1-[(3S)-3-hydroxypyrrolidin-1-yl]-2-(oxan-4-ylamino)-2-oxoethyl]phenyl]prop-2-enamide.
| Compound Name | N-(2-aminophenyl)-3-[4-[1-[(3S)-3-hydroxypyrrolidin-1-yl]-2-(oxan-4-ylamino)-2-oxoethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 91165032 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | N-(2-aminophenyl)-3-[4-[1-[(3S)-3-hydroxypyrrolidin-1-yl]-2-(oxan-4-ylamino)-2-oxoethyl]phenyl]prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)C=Cc1ccc(C(C(=O)NC2CCOCC2)N2CC[C@H](O)C2)cc1 |
| InChI | InChI=1S/C26H32N4O4/c27-22-3-1-2-4-23(22)29-24(32)10-7-18-5-8-19(9-6-18)25(30-14-11-21(31)17-30)26(33)28-20-12-15-34-16-13-20/h1-10,20-21,25,31H,11-17,27H2,(H,28,33)(H,29,32)/t21-,25?/m0/s1 |
| InChIKey | UQKUJEWVEREHNO-BWDMCYIDSA-N |
| XLogP | 2.32 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|