C22H27ClN4O3 — CID 140526726
(E)-N-(2-aminophenyl)-3-[4-(2-morpholin-4-ylethoxyiminomethyl)phenyl]prop-2-enamide;hydrochloride (PubChem CID 140526726) has the molecular formula C22H27ClN4O3 and a molecular weight of 430.94 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[4-(2-morpholin-4-ylethoxyiminomethyl)phenyl]prop-2-enamide;hydrochloride.
| Compound Name | (E)-N-(2-aminophenyl)-3-[4-(2-morpholin-4-ylethoxyiminomethyl)phenyl]prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 140526726 |
| Molecular Formula | C22H27ClN4O3 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[4-(2-morpholin-4-ylethoxyiminomethyl)phenyl]prop-2-enamide;hydrochloride |
| SMILES | Cl.Nc1ccccc1NC(=O)/C=C/c1ccc(C=NOCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C22H26N4O3.ClH/c23-20-3-1-2-4-21(20)25-22(27)10-9-18-5-7-19(8-6-18)17-24-29-16-13-26-11-14-28-15-12-26;/h1-10,17H,11-16,23H2,(H,25,27);1H/b10-9+,24-17?; |
| InChIKey | GYYUWFNCIFKBEJ-HFWQAORDSA-N |
| XLogP | 3.03 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|