C16H20N2O4 — CID 173100165
3-[4-(2-morpholin-4-ylethoxyiminomethyl)phenyl]prop-2-enoic acid (PubChem CID 173100165) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 3-[4-(2-morpholin-4-ylethoxyiminomethyl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-(2-morpholin-4-ylethoxyiminomethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 173100165 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3-[4-(2-morpholin-4-ylethoxyiminomethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(C=NOCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C16H20N2O4/c19-16(20)6-5-14-1-3-15(4-2-14)13-17-22-12-9-18-7-10-21-11-8-18/h1-6,13H,7-12H2,(H,19,20) |
| InChIKey | XROCVKOZFGYYTA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|